| Name | 2-Amino-5-bromobenzoic acid |
| Synonyms | RARECHEM AL BO 1183 5-Bromoanthranili Acid 2-Amino-5-bromobenzoic 5-bromo-anthranilicaci 5-BROMOANTHRANILIC ACID 2-amino-5-bromobenzoate 5-Bromoantharanilic Acid 2-amino-5-bromo-benzoicaci Anthranilic acid, 5-bromo- 5-BROMO-2-AMINOBENZOIC ACID 2-Amino-5-bromobenzoic acid 2-amnio-5-bromo-benzoic acid Benzoic acid, 2-amino-5-bromo- 2 - aMino - 5 - broMine benzoic acid |
| CAS | 5794-88-7 |
| EINECS | 227-338-3 |
| InChI | InChI=1/C7H6BrNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11)/p-1 |
| Molecular Formula | C7H6BrNO2 |
| Molar Mass | 216.03 |
| Density | 1.6841 (rough estimate) |
| Melting Point | 213-215 °C (lit.) |
| Boling Point | 265.51°C (rough estimate) |
| Flash Point | 160.9°C |
| Solubility | Soluble in methanol and dimethyl sulfoxide. |
| Vapor Presure | 2.91E-05mmHg at 25°C |
| Appearance | Pale yellow to white powder |
| Color | Beige |
| Merck | 14,1405 |
| BRN | 639028 |
| pKa | 4.55±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Light Sensitive |
| Refractive Index | 1.6120 (estimate) |
| MDL | MFCD00007823 |
| Physical and Chemical Properties | Appearance: light brown crystal Melting Point: 215-220 ℃ |
| Use | Organic intermediates. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37 - Irritating to eyes and respiratory system. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S38 - In case of insufficient ventilation, wear suitable respiratory equipment. S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CB2557670 |
| HS Code | 29224999 |
| Hazard Note | Harmful |
| Packing Group | 6.1/PG 3 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | organic intermediates, dye intermediates. As an analytical reagent for the analysis of cobalt, copper, nickel and zinc for the synthesis of organic intermediates, dye intermediates, as an analytical reagent for the analysis of cobalt, copper, nickel and zinc |
| production method | O-aminobenzoic acid was obtained by bromination. |